C17H21ClN2 — CID 114851960
4-chloro-N-methyl-2-(methylaminomethyl)-N-(2-phenylethyl)aniline (PubChem CID 114851960) has the molecular formula C17H21ClN2 and a molecular weight of 288.82 g/mol. Its IUPAC name is 4-chloro-N-methyl-2-(methylaminomethyl)-N-(2-phenylethyl)aniline.
| Compound Name | 4-chloro-N-methyl-2-(methylaminomethyl)-N-(2-phenylethyl)aniline |
|---|---|
| PubChem CID | 114851960 |
| Molecular Formula | C17H21ClN2 |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 4-chloro-N-methyl-2-(methylaminomethyl)-N-(2-phenylethyl)aniline |
| SMILES | CNCc1cc(Cl)ccc1N(C)CCc1ccccc1 |
| InChI | InChI=1S/C17H21ClN2/c1-19-13-15-12-16(18)8-9-17(15)20(2)11-10-14-6-4-3-5-7-14/h3-9,12,19H,10-11,13H2,1-2H3 |
| InChIKey | GZTLEOKRWNQVPT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |