C10H14ClFN2O — CID 66077409
4-chloro-1-N-(2-ethoxyethyl)-5-fluorobenzene-1,2-diamine (PubChem CID 66077409) has the molecular formula C10H14ClFN2O and a molecular weight of 232.69 g/mol. Its IUPAC name is 4-chloro-1-N-(2-ethoxyethyl)-5-fluorobenzene-1,2-diamine.
| Compound Name | 4-chloro-1-N-(2-ethoxyethyl)-5-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 66077409 |
| Molecular Formula | C10H14ClFN2O |
| Molecular Weight | 232.69 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 4-chloro-1-N-(2-ethoxyethyl)-5-fluorobenzene-1,2-diamine |
| SMILES | CCOCCNc1cc(F)c(Cl)cc1N |
| InChI | InChI=1S/C10H14ClFN2O/c1-2-15-4-3-14-10-6-8(12)7(11)5-9(10)13/h5-6,14H,2-4,13H2,1H3 |
| InChIKey | AZVRTDVBZJYDMS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.69 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|