C10H13ClN2 — CID 115468475
4-chloro-2-N-(cyclopropylmethyl)benzene-1,2-diamine (PubChem CID 115468475) has the molecular formula C10H13ClN2 and a molecular weight of 196.68 g/mol. Its IUPAC name is 4-chloro-2-N-(cyclopropylmethyl)benzene-1,2-diamine.
| Compound Name | 4-chloro-2-N-(cyclopropylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 115468475 |
| Molecular Formula | C10H13ClN2 |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 4-chloro-2-N-(cyclopropylmethyl)benzene-1,2-diamine |
| SMILES | Nc1ccc(Cl)cc1NCC1CC1 |
| InChI | InChI=1S/C10H13ClN2/c11-8-3-4-9(12)10(5-8)13-6-7-1-2-7/h3-5,7,13H,1-2,6,12H2 |
| InChIKey | DMZCPESSINOEDV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|