C10H8IN3O3 — CID 106419092
2-iodo-4-nitro-N-(1,2-oxazol-5-ylmethyl)aniline (PubChem CID 106419092) has the molecular formula C10H8IN3O3 and a molecular weight of 345.10 g/mol. Its IUPAC name is 2-iodo-4-nitro-N-(1,2-oxazol-5-ylmethyl)aniline.
| Compound Name | 2-iodo-4-nitro-N-(1,2-oxazol-5-ylmethyl)aniline |
|---|---|
| PubChem CID | 106419092 |
| Molecular Formula | C10H8IN3O3 |
| Molecular Weight | 345.10 g/mol |
| Exact Mass | 344.96 |
| IUPAC Name | 2-iodo-4-nitro-N-(1,2-oxazol-5-ylmethyl)aniline |
| SMILES | O=[N+]([O-])c1ccc(NCc2ccno2)c(I)c1 |
| InChI | InChI=1S/C10H8IN3O3/c11-9-5-7(14(15)16)1-2-10(9)12-6-8-3-4-13-17-8/h1-5,12H,6H2 |
| InChIKey | DXSQYEQQJPGBSW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.10 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|