C16H19FN2 — CID 115124810
4-fluoro-1-N-[(2,4,5-trimethylphenyl)methyl]benzene-1,2-diamine (PubChem CID 115124810) has the molecular formula C16H19FN2 and a molecular weight of 258.34 g/mol. Its IUPAC name is 4-fluoro-1-N-[(2,4,5-trimethylphenyl)methyl]benzene-1,2-diamine.
| Compound Name | 4-fluoro-1-N-[(2,4,5-trimethylphenyl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 115124810 |
| Molecular Formula | C16H19FN2 |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 4-fluoro-1-N-[(2,4,5-trimethylphenyl)methyl]benzene-1,2-diamine |
| SMILES | Cc1cc(C)c(CNc2ccc(F)cc2N)cc1C |
| InChI | InChI=1S/C16H19FN2/c1-10-6-12(3)13(7-11(10)2)9-19-16-5-4-14(17)8-15(16)18/h4-8,19H,9,18H2,1-3H3 |
| InChIKey | NHPGOHIZJMJQKT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|