C20H18ClN5O2S — CID 129228404
4-[[(6-amino-1H-benzimidazol-2-yl)amino]methyl]-N-(4-chlorophenyl)benzenesulfonamide (PubChem CID 129228404) has the molecular formula C20H18ClN5O2S and a molecular weight of 427.92 g/mol. Its IUPAC name is 4-[[(6-amino-1H-benzimidazol-2-yl)amino]methyl]-N-(4-chlorophenyl)benzenesulfonamide.
| Compound Name | 4-[[(6-amino-1H-benzimidazol-2-yl)amino]methyl]-N-(4-chlorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 129228404 |
| Molecular Formula | C20H18ClN5O2S |
| Molecular Weight | 427.92 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 4-[[(6-amino-1H-benzimidazol-2-yl)amino]methyl]-N-(4-chlorophenyl)benzenesulfonamide |
| SMILES | Nc1ccc2nc(NCc3ccc(S(=O)(=O)Nc4ccc(Cl)cc4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C20H18ClN5O2S/c21-14-3-6-16(7-4-14)26-29(27,28)17-8-1-13(2-9-17)12-23-20-24-18-10-5-15(22)11-19(18)25-20/h1-11,26H,12,22H2,(H2,23,24,25) |
| InChIKey | AKFIBYSFKLMZOA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.92 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|