C13H12Cl4N4 — CID 24970676
2-N-(3,4-dichlorophenyl)-3H-benzimidazole-2,5-diamine;dihydrochloride (PubChem CID 24970676) has the molecular formula C13H12Cl4N4 and a molecular weight of 366.08 g/mol. Its IUPAC name is 2-N-(3,4-dichlorophenyl)-3H-benzimidazole-2,5-diamine;dihydrochloride.
| Compound Name | 2-N-(3,4-dichlorophenyl)-3H-benzimidazole-2,5-diamine;dihydrochloride |
|---|---|
| PubChem CID | 24970676 |
| Molecular Formula | C13H12Cl4N4 |
| Molecular Weight | 366.08 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | 2-N-(3,4-dichlorophenyl)-3H-benzimidazole-2,5-diamine;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc2nc(Nc3ccc(Cl)c(Cl)c3)[nH]c2c1 |
| InChI | InChI=1S/C13H10Cl2N4.2ClH/c14-9-3-2-8(6-10(9)15)17-13-18-11-4-1-7(16)5-12(11)19-13;;/h1-6H,16H2,(H2,17,18,19);2*1H |
| InChIKey | MHIDBSOJSJOLKT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.08 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|