About 6-chloro-N-(3,5-dichlorophenyl)-1H-benzimidazol-2-amine;hydrochloride
6-chloro-N-(3,5-dichlorophenyl)-1H-benzimidazol-2-amine;hydrochloride (PubChem CID 24970552) has the molecular formula C13H9Cl4N3
and a molecular weight of 349.05 g/mol. Its IUPAC name is 6-chloro-N-(3,5-dichlorophenyl)-1H-benzimidazol-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 6-chloro-N-(3,5-dichlorophenyl)-1H-benzimidazol-2-amine;hydrochloride |
| PubChem CID | 24970552 |
| Molecular Formula | C13H9Cl4N3 |
| Molecular Weight | 349.05 g/mol |
| Exact Mass | 346.96 |
| IUPAC Name | 6-chloro-N-(3,5-dichlorophenyl)-1H-benzimidazol-2-amine;hydrochloride |
| SMILES | Cl.Clc1cc(Cl)cc(Nc2nc3ccc(Cl)cc3[nH]2)c1 |
| InChI | InChI=1S/C13H8Cl3N3.ClH/c14-7-1-2-11-12(6-7)19-13(18-11)17-10-4-8(15)3-9(16)5-10;/h1-6H,(H2,17,18,19);1H |
| InChIKey | KSMLRRNPDIIKRW-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.05 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-N-(3,5-dichlorophenyl)-1H-benzimidazol-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-(3,5-dichlorophenyl)-1H-benzimidazol-2-amine;hydrochloride?
The IUPAC name of 6-chloro-N-(3,5-dichlorophenyl)-1H-benzimidazol-2-amine;hydrochloride (CID 24970552) is 6-chloro-N-(3,5-dichlorophenyl)-1H-benzimidazol-2-amine;hydrochloride.
What is the SMILES notation for 6-chloro-N-(3,5-dichlorophenyl)-1H-benzimidazol-2-amine;hydrochloride?
The canonical SMILES for 6-chloro-N-(3,5-dichlorophenyl)-1H-benzimidazol-2-amine;hydrochloride is Cl.Clc1cc(Cl)cc(Nc2nc3ccc(Cl)cc3[nH]2)c1.
What is the InChIKey of 6-chloro-N-(3,5-dichlorophenyl)-1H-benzimidazol-2-amine;hydrochloride?
The InChIKey is KSMLRRNPDIIKRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Cl3N3.ClH/c14-7-1-2-11-12(6-7)19-13(18-11)17-10-4-8(15)3-9(16)5-10;/h1-6H,(H2,17,18,19);1H.
What are the key properties of 6-chloro-N-(3,5-dichlorophenyl)-1H-benzimidazol-2-amine;hydrochloride?
6-chloro-N-(3,5-dichlorophenyl)-1H-benzimidazol-2-amine;hydrochloride has a molecular weight of 349.05 g/mol, XLogP of 5.69, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-(3,5-dichlorophenyl)-1H-benzimidazol-2-amine;hydrochloride is sourced from PubChem (CID 24970552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).