C19H15N3S — CID 117083026
2-(1-benzothiophen-3-yl)-N-benzylpyrimidin-4-amine (PubChem CID 117083026) has the molecular formula C19H15N3S and a molecular weight of 317.42 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-N-benzylpyrimidin-4-amine.
| Compound Name | 2-(1-benzothiophen-3-yl)-N-benzylpyrimidin-4-amine |
|---|---|
| PubChem CID | 117083026 |
| Molecular Formula | C19H15N3S |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-N-benzylpyrimidin-4-amine |
| SMILES | c1ccc(CNc2ccnc(-c3csc4ccccc34)n2)cc1 |
| InChI | InChI=1S/C19H15N3S/c1-2-6-14(7-3-1)12-21-18-10-11-20-19(22-18)16-13-23-17-9-5-4-8-15(16)17/h1-11,13H,12H2,(H,20,21,22) |
| InChIKey | MWUMHEJOTQKQBB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |