C19H14N2OS2 — CID 117084082
2-(1-benzothiophen-3-yl)-N-benzyl-1,3-thiazole-4-carboxamide (PubChem CID 117084082) has the molecular formula C19H14N2OS2 and a molecular weight of 350.47 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-N-benzyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(1-benzothiophen-3-yl)-N-benzyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 117084082 |
| Molecular Formula | C19H14N2OS2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-N-benzyl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1csc(-c2csc3ccccc23)n1 |
| InChI | InChI=1S/C19H14N2OS2/c22-18(20-10-13-6-2-1-3-7-13)16-12-24-19(21-16)15-11-23-17-9-5-4-8-14(15)17/h1-9,11-12H,10H2,(H,20,22) |
| InChIKey | HTYIKANDIZCRFV-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |