C26H21N3OS — CID 18729967
N-[[4-(aminomethyl)phenyl]methyl]-2-(1-benzothiophen-3-yl)quinoline-4-carboxamide (PubChem CID 18729967) has the molecular formula C26H21N3OS and a molecular weight of 423.54 g/mol. Its IUPAC name is N-[[4-(aminomethyl)phenyl]methyl]-2-(1-benzothiophen-3-yl)quinoline-4-carboxamide.
| Compound Name | N-[[4-(aminomethyl)phenyl]methyl]-2-(1-benzothiophen-3-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 18729967 |
| Molecular Formula | C26H21N3OS |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | N-[[4-(aminomethyl)phenyl]methyl]-2-(1-benzothiophen-3-yl)quinoline-4-carboxamide |
| SMILES | NCc1ccc(CNC(=O)c2cc(-c3csc4ccccc34)nc3ccccc23)cc1 |
| InChI | InChI=1S/C26H21N3OS/c27-14-17-9-11-18(12-10-17)15-28-26(30)21-13-24(29-23-7-3-1-5-19(21)23)22-16-31-25-8-4-2-6-20(22)25/h1-13,16H,14-15,27H2,(H,28,30) |
| InChIKey | YVNPNTQRBSSTML-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |