C27H21IN4O — CID 18729976
N-[[4-(aminomethyl)phenyl]methyl]-6-iodo-2-quinolin-3-ylquinoline-4-carboxamide (PubChem CID 18729976) has the molecular formula C27H21IN4O and a molecular weight of 544.40 g/mol. Its IUPAC name is N-[[4-(aminomethyl)phenyl]methyl]-6-iodo-2-quinolin-3-ylquinoline-4-carboxamide.
| Compound Name | N-[[4-(aminomethyl)phenyl]methyl]-6-iodo-2-quinolin-3-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 18729976 |
| Molecular Formula | C27H21IN4O |
| Molecular Weight | 544.40 g/mol |
| Exact Mass | 544.08 |
| IUPAC Name | N-[[4-(aminomethyl)phenyl]methyl]-6-iodo-2-quinolin-3-ylquinoline-4-carboxamide |
| SMILES | NCc1ccc(CNC(=O)c2cc(-c3cnc4ccccc4c3)nc3ccc(I)cc23)cc1 |
| InChI | InChI=1S/C27H21IN4O/c28-21-9-10-25-22(12-21)23(27(33)31-15-18-7-5-17(14-29)6-8-18)13-26(32-25)20-11-19-3-1-2-4-24(19)30-16-20/h1-13,16H,14-15,29H2,(H,31,33) |
| InChIKey | FZZNFOIMQFWNQC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.40 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|