C24H21N3O — CID 69053992
N-[(2-ethyl-4-pyridinyl)methyl]-2-phenylquinoline-4-carboxamide (PubChem CID 69053992) has the molecular formula C24H21N3O and a molecular weight of 367.45 g/mol. Its IUPAC name is N-[(2-ethyl-4-pyridinyl)methyl]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(2-ethyl-4-pyridinyl)methyl]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 69053992 |
| Molecular Formula | C24H21N3O |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | N-[(2-ethyl-4-pyridinyl)methyl]-2-phenylquinoline-4-carboxamide |
| SMILES | CCc1cc(CNC(=O)c2cc(-c3ccccc3)nc3ccccc23)ccn1 |
| InChI | InChI=1S/C24H21N3O/c1-2-19-14-17(12-13-25-19)16-26-24(28)21-15-23(18-8-4-3-5-9-18)27-22-11-7-6-10-20(21)22/h3-15H,2,16H2,1H3,(H,26,28) |
| InChIKey | ITPLFVLPMOBQGJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |