C22H18BrN3OS — CID 18729972
N-[[4-(aminomethyl)phenyl]methyl]-6-bromo-2-thiophen-3-ylquinoline-4-carboxamide (PubChem CID 18729972) has the molecular formula C22H18BrN3OS and a molecular weight of 452.38 g/mol. Its IUPAC name is N-[[4-(aminomethyl)phenyl]methyl]-6-bromo-2-thiophen-3-ylquinoline-4-carboxamide.
| Compound Name | N-[[4-(aminomethyl)phenyl]methyl]-6-bromo-2-thiophen-3-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 18729972 |
| Molecular Formula | C22H18BrN3OS |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | N-[[4-(aminomethyl)phenyl]methyl]-6-bromo-2-thiophen-3-ylquinoline-4-carboxamide |
| SMILES | NCc1ccc(CNC(=O)c2cc(-c3ccsc3)nc3ccc(Br)cc23)cc1 |
| InChI | InChI=1S/C22H18BrN3OS/c23-17-5-6-20-18(9-17)19(10-21(26-20)16-7-8-28-13-16)22(27)25-12-15-3-1-14(11-24)2-4-15/h1-10,13H,11-12,24H2,(H,25,27) |
| InChIKey | RCWOBCYLURUGTA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |