C19H20BrN4O+ — CID 7472552
2-[(6-bromo-2-pyridin-4-ylquinoline-4-carbonyl)amino]ethyl-dimethylazanium (PubChem CID 7472552) has the molecular formula C19H20BrN4O+ and a molecular weight of 400.30 g/mol. Its IUPAC name is 2-[(6-bromo-2-pyridin-4-ylquinoline-4-carbonyl)amino]ethyl-dimethylazanium.
| Compound Name | 2-[(6-bromo-2-pyridin-4-ylquinoline-4-carbonyl)amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7472552 |
| Molecular Formula | C19H20BrN4O+ |
| Molecular Weight | 400.30 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 2-[(6-bromo-2-pyridin-4-ylquinoline-4-carbonyl)amino]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCNC(=O)c1cc(-c2ccncc2)nc2ccc(Br)cc12 |
| InChI | InChI=1S/C19H19BrN4O/c1-24(2)10-9-22-19(25)16-12-18(13-5-7-21-8-6-13)23-17-4-3-14(20)11-15(16)17/h3-8,11-12H,9-10H2,1-2H3,(H,22,25)/p+1 |
| InChIKey | QFMZUUOHTRBZGR-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 59.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |