C27H23BrN4O — CID 18729956
N-[[4-(aminomethyl)phenyl]methyl]-2-(5-bromo-1-methylindol-3-yl)quinoline-4-carboxamide (PubChem CID 18729956) has the molecular formula C27H23BrN4O and a molecular weight of 499.41 g/mol. Its IUPAC name is N-[[4-(aminomethyl)phenyl]methyl]-2-(5-bromo-1-methylindol-3-yl)quinoline-4-carboxamide.
| Compound Name | N-[[4-(aminomethyl)phenyl]methyl]-2-(5-bromo-1-methylindol-3-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 18729956 |
| Molecular Formula | C27H23BrN4O |
| Molecular Weight | 499.41 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | N-[[4-(aminomethyl)phenyl]methyl]-2-(5-bromo-1-methylindol-3-yl)quinoline-4-carboxamide |
| SMILES | Cn1cc(-c2cc(C(=O)NCc3ccc(CN)cc3)c3ccccc3n2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C27H23BrN4O/c1-32-16-23(21-12-19(28)10-11-26(21)32)25-13-22(20-4-2-3-5-24(20)31-25)27(33)30-15-18-8-6-17(14-29)7-9-18/h2-13,16H,14-15,29H2,1H3,(H,30,33) |
| InChIKey | FGRWUSWAWFEQLE-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.41 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |