C27H22BrIN4O — CID 18729833
N-[[3-(aminomethyl)phenyl]methyl]-2-(5-bromo-1-methylindol-3-yl)-7-iodoquinoline-4-carboxamide (PubChem CID 18729833) has the molecular formula C27H22BrIN4O and a molecular weight of 625.31 g/mol. Its IUPAC name is N-[[3-(aminomethyl)phenyl]methyl]-2-(5-bromo-1-methylindol-3-yl)-7-iodoquinoline-4-carboxamide.
| Compound Name | N-[[3-(aminomethyl)phenyl]methyl]-2-(5-bromo-1-methylindol-3-yl)-7-iodoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 18729833 |
| Molecular Formula | C27H22BrIN4O |
| Molecular Weight | 625.31 g/mol |
| Exact Mass | 624.00 |
| IUPAC Name | N-[[3-(aminomethyl)phenyl]methyl]-2-(5-bromo-1-methylindol-3-yl)-7-iodoquinoline-4-carboxamide |
| SMILES | Cn1cc(-c2cc(C(=O)NCc3cccc(CN)c3)c3ccc(I)cc3n2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C27H22BrIN4O/c1-33-15-23(21-10-18(28)5-8-26(21)33)25-12-22(20-7-6-19(29)11-24(20)32-25)27(34)31-14-17-4-2-3-16(9-17)13-30/h2-12,15H,13-14,30H2,1H3,(H,31,34) |
| InChIKey | BUHOUXJBCQIAOG-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.31 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|