C26H26BrIN4O — CID 18729811
N-[[3-(aminomethyl)cyclohexyl]methyl]-2-(5-bromo-1H-indol-3-yl)-7-iodoquinoline-4-carboxamide (PubChem CID 18729811) has the molecular formula C26H26BrIN4O and a molecular weight of 617.33 g/mol. Its IUPAC name is N-[[3-(aminomethyl)cyclohexyl]methyl]-2-(5-bromo-1H-indol-3-yl)-7-iodoquinoline-4-carboxamide.
| Compound Name | N-[[3-(aminomethyl)cyclohexyl]methyl]-2-(5-bromo-1H-indol-3-yl)-7-iodoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 18729811 |
| Molecular Formula | C26H26BrIN4O |
| Molecular Weight | 617.33 g/mol |
| Exact Mass | 616.03 |
| IUPAC Name | N-[[3-(aminomethyl)cyclohexyl]methyl]-2-(5-bromo-1H-indol-3-yl)-7-iodoquinoline-4-carboxamide |
| SMILES | NCC1CCCC(CNC(=O)c2cc(-c3c[nH]c4ccc(Br)cc34)nc3cc(I)ccc23)C1 |
| InChI | InChI=1S/C26H26BrIN4O/c27-17-4-7-23-20(9-17)22(14-30-23)25-11-21(19-6-5-18(28)10-24(19)32-25)26(33)31-13-16-3-1-2-15(8-16)12-29/h4-7,9-11,14-16,30H,1-3,8,12-13,29H2,(H,31,33) |
| InChIKey | DTWKUFUSBNQWPT-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.33 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|