C26H27BrN4O — CID 18729868
N-[[4-(aminomethyl)cyclohexyl]methyl]-2-(5-bromo-1H-indol-3-yl)quinoline-4-carboxamide (PubChem CID 18729868) has the molecular formula C26H27BrN4O and a molecular weight of 491.43 g/mol. Its IUPAC name is N-[[4-(aminomethyl)cyclohexyl]methyl]-2-(5-bromo-1H-indol-3-yl)quinoline-4-carboxamide.
| Compound Name | N-[[4-(aminomethyl)cyclohexyl]methyl]-2-(5-bromo-1H-indol-3-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 18729868 |
| Molecular Formula | C26H27BrN4O |
| Molecular Weight | 491.43 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | N-[[4-(aminomethyl)cyclohexyl]methyl]-2-(5-bromo-1H-indol-3-yl)quinoline-4-carboxamide |
| SMILES | NCC1CCC(CNC(=O)c2cc(-c3c[nH]c4ccc(Br)cc34)nc3ccccc23)CC1 |
| InChI | InChI=1S/C26H27BrN4O/c27-18-9-10-23-20(11-18)22(15-29-23)25-12-21(19-3-1-2-4-24(19)31-25)26(32)30-14-17-7-5-16(13-28)6-8-17/h1-4,9-12,15-17,29H,5-8,13-14,28H2,(H,30,32) |
| InChIKey | IOOXJKMFVKIWPM-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.43 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |