C22H19BrN4O — CID 18729636
(3-aminopyrrolidin-1-yl)-[2-(5-bromo-1H-indol-3-yl)quinolin-4-yl]methanone (PubChem CID 18729636) has the molecular formula C22H19BrN4O and a molecular weight of 435.33 g/mol. Its IUPAC name is (3-aminopyrrolidin-1-yl)-[2-(5-bromo-1H-indol-3-yl)quinolin-4-yl]methanone.
| Compound Name | (3-aminopyrrolidin-1-yl)-[2-(5-bromo-1H-indol-3-yl)quinolin-4-yl]methanone |
|---|---|
| PubChem CID | 18729636 |
| Molecular Formula | C22H19BrN4O |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | (3-aminopyrrolidin-1-yl)-[2-(5-bromo-1H-indol-3-yl)quinolin-4-yl]methanone |
| SMILES | NC1CCN(C(=O)c2cc(-c3c[nH]c4ccc(Br)cc34)nc3ccccc23)C1 |
| InChI | InChI=1S/C22H19BrN4O/c23-13-5-6-19-16(9-13)18(11-25-19)21-10-17(15-3-1-2-4-20(15)26-21)22(28)27-8-7-14(24)12-27/h1-6,9-11,14,25H,7-8,12,24H2 |
| InChIKey | JPZDPGNVPDSCDJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |