C17H23Cl2N3O — CID 119413204
[(3R)-3-aminopyrrolidin-1-yl]-(2-propan-2-ylquinolin-4-yl)methanone;dihydrochloride (PubChem CID 119413204) has the molecular formula C17H23Cl2N3O and a molecular weight of 356.30 g/mol. Its IUPAC name is [(3R)-3-aminopyrrolidin-1-yl]-(2-propan-2-ylquinolin-4-yl)methanone;dihydrochloride.
| Compound Name | [(3R)-3-aminopyrrolidin-1-yl]-(2-propan-2-ylquinolin-4-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119413204 |
| Molecular Formula | C17H23Cl2N3O |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | [(3R)-3-aminopyrrolidin-1-yl]-(2-propan-2-ylquinolin-4-yl)methanone;dihydrochloride |
| SMILES | CC(C)c1cc(C(=O)N2CC[C@@H](N)C2)c2ccccc2n1.Cl.Cl |
| InChI | InChI=1S/C17H21N3O.2ClH/c1-11(2)16-9-14(13-5-3-4-6-15(13)19-16)17(21)20-8-7-12(18)10-20;;/h3-6,9,11-12H,7-8,10,18H2,1-2H3;2*1H/t12-;;/m1../s1 |
| InChIKey | AKLJGYFXFBJTFZ-CURYUGHLSA-N |
| XLogP | 3.38 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |