C19H27Cl2N3O — CID 119493389
[3-(methylamino)piperidin-1-yl]-(2-propan-2-ylquinolin-4-yl)methanone;dihydrochloride (PubChem CID 119493389) has the molecular formula C19H27Cl2N3O and a molecular weight of 384.35 g/mol. Its IUPAC name is [3-(methylamino)piperidin-1-yl]-(2-propan-2-ylquinolin-4-yl)methanone;dihydrochloride.
| Compound Name | [3-(methylamino)piperidin-1-yl]-(2-propan-2-ylquinolin-4-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119493389 |
| Molecular Formula | C19H27Cl2N3O |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | [3-(methylamino)piperidin-1-yl]-(2-propan-2-ylquinolin-4-yl)methanone;dihydrochloride |
| SMILES | CNC1CCCN(C(=O)c2cc(C(C)C)nc3ccccc23)C1.Cl.Cl |
| InChI | InChI=1S/C19H25N3O.2ClH/c1-13(2)18-11-16(15-8-4-5-9-17(15)21-18)19(23)22-10-6-7-14(12-22)20-3;;/h4-5,8-9,11,13-14,20H,6-7,10,12H2,1-3H3;2*1H |
| InChIKey | JIAMJWCRQMDWSB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |