C17H23Cl2N3O — CID 126772613
[3-(methylamino)piperidin-1-yl]-(2-methylquinolin-3-yl)methanone;dihydrochloride (PubChem CID 126772613) has the molecular formula C17H23Cl2N3O and a molecular weight of 356.30 g/mol. Its IUPAC name is [3-(methylamino)piperidin-1-yl]-(2-methylquinolin-3-yl)methanone;dihydrochloride.
| Compound Name | [3-(methylamino)piperidin-1-yl]-(2-methylquinolin-3-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 126772613 |
| Molecular Formula | C17H23Cl2N3O |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | [3-(methylamino)piperidin-1-yl]-(2-methylquinolin-3-yl)methanone;dihydrochloride |
| SMILES | CNC1CCCN(C(=O)c2cc3ccccc3nc2C)C1.Cl.Cl |
| InChI | InChI=1S/C17H21N3O.2ClH/c1-12-15(10-13-6-3-4-8-16(13)19-12)17(21)20-9-5-7-14(11-20)18-2;;/h3-4,6,8,10,14,18H,5,7,9,11H2,1-2H3;2*1H |
| InChIKey | NBFSPXKHBBJROD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |