C26H25BrClIN4O — CID 18729865
N-[[4-(aminomethyl)cyclohexyl]methyl]-2-(5-bromo-1H-indol-3-yl)-7-chloro-6-iodoquinoline-4-carboxamide (PubChem CID 18729865) has the molecular formula C26H25BrClIN4O and a molecular weight of 651.77 g/mol. Its IUPAC name is N-[[4-(aminomethyl)cyclohexyl]methyl]-2-(5-bromo-1H-indol-3-yl)-7-chloro-6-iodoquinoline-4-carboxamide.
| Compound Name | N-[[4-(aminomethyl)cyclohexyl]methyl]-2-(5-bromo-1H-indol-3-yl)-7-chloro-6-iodoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 18729865 |
| Molecular Formula | C26H25BrClIN4O |
| Molecular Weight | 651.77 g/mol |
| Exact Mass | 649.99 |
| IUPAC Name | N-[[4-(aminomethyl)cyclohexyl]methyl]-2-(5-bromo-1H-indol-3-yl)-7-chloro-6-iodoquinoline-4-carboxamide |
| SMILES | NCC1CCC(CNC(=O)c2cc(-c3c[nH]c4ccc(Br)cc34)nc3cc(Cl)c(I)cc23)CC1 |
| InChI | InChI=1S/C26H25BrClIN4O/c27-16-5-6-23-17(7-16)20(13-31-23)24-9-19(18-8-22(29)21(28)10-25(18)33-24)26(34)32-12-15-3-1-14(11-30)2-4-15/h5-10,13-15,31H,1-4,11-12,30H2,(H,32,34) |
| InChIKey | UYUKIAIZUSNYJA-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.77 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|