C27H25BrClN5OS — CID 18729770
N-(2-aminoethyl)-2-(5-bromo-1H-indol-3-yl)-7-chloro-6-(3-thiomorpholin-4-ylprop-1-ynyl)quinoline-4-carboxamide (PubChem CID 18729770) has the molecular formula C27H25BrClN5OS and a molecular weight of 582.96 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-(5-bromo-1H-indol-3-yl)-7-chloro-6-(3-thiomorpholin-4-ylprop-1-ynyl)quinoline-4-carboxamide.
| Compound Name | N-(2-aminoethyl)-2-(5-bromo-1H-indol-3-yl)-7-chloro-6-(3-thiomorpholin-4-ylprop-1-ynyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 18729770 |
| Molecular Formula | C27H25BrClN5OS |
| Molecular Weight | 582.96 g/mol |
| Exact Mass | 581.07 |
| IUPAC Name | N-(2-aminoethyl)-2-(5-bromo-1H-indol-3-yl)-7-chloro-6-(3-thiomorpholin-4-ylprop-1-ynyl)quinoline-4-carboxamide |
| SMILES | NCCNC(=O)c1cc(-c2c[nH]c3ccc(Br)cc23)nc2cc(Cl)c(C#CCN3CCSCC3)cc12 |
| InChI | InChI=1S/C27H25BrClN5OS/c28-18-3-4-24-20(13-18)22(16-32-24)25-14-21(27(35)31-6-5-30)19-12-17(23(29)15-26(19)33-25)2-1-7-34-8-10-36-11-9-34/h3-4,12-16,32H,5-11,30H2,(H,31,35) |
| InChIKey | DRVFRVQGLZTSQV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.96 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|