C21H18BrN3O — CID 59950814
N-(2-aminoethyl)-3-(5-bromo-1H-indol-3-yl)naphthalene-1-carboxamide (PubChem CID 59950814) has the molecular formula C21H18BrN3O and a molecular weight of 408.30 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-(5-bromo-1H-indol-3-yl)naphthalene-1-carboxamide.
| Compound Name | N-(2-aminoethyl)-3-(5-bromo-1H-indol-3-yl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 59950814 |
| Molecular Formula | C21H18BrN3O |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | N-(2-aminoethyl)-3-(5-bromo-1H-indol-3-yl)naphthalene-1-carboxamide |
| SMILES | NCCNC(=O)c1cc(-c2c[nH]c3ccc(Br)cc23)cc2ccccc12 |
| InChI | InChI=1S/C21H18BrN3O/c22-15-5-6-20-17(11-15)19(12-25-20)14-9-13-3-1-2-4-16(13)18(10-14)21(26)24-8-7-23/h1-6,9-12,25H,7-8,23H2,(H,24,26) |
| InChIKey | BXEQIMAMPDWAGD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |