C37H32BrN5O — CID 18729899
N-[[4-(aminomethyl)phenyl]methyl]-2-(5-bromo-1H-indol-3-yl)-6-[3-(2-phenylethylamino)prop-1-ynyl]quinoline-4-carboxamide (PubChem CID 18729899) has the molecular formula C37H32BrN5O and a molecular weight of 642.60 g/mol. Its IUPAC name is N-[[4-(aminomethyl)phenyl]methyl]-2-(5-bromo-1H-indol-3-yl)-6-[3-(2-phenylethylamino)prop-1-ynyl]quinoline-4-carboxamide.
| Compound Name | N-[[4-(aminomethyl)phenyl]methyl]-2-(5-bromo-1H-indol-3-yl)-6-[3-(2-phenylethylamino)prop-1-ynyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 18729899 |
| Molecular Formula | C37H32BrN5O |
| Molecular Weight | 642.60 g/mol |
| Exact Mass | 641.18 |
| IUPAC Name | N-[[4-(aminomethyl)phenyl]methyl]-2-(5-bromo-1H-indol-3-yl)-6-[3-(2-phenylethylamino)prop-1-ynyl]quinoline-4-carboxamide |
| SMILES | NCc1ccc(CNC(=O)c2cc(-c3c[nH]c4ccc(Br)cc34)nc3ccc(C#CCNCCc4ccccc4)cc23)cc1 |
| InChI | InChI=1S/C37H32BrN5O/c38-29-13-15-34-31(20-29)33(24-41-34)36-21-32(37(44)42-23-28-10-8-27(22-39)9-11-28)30-19-26(12-14-35(30)43-36)7-4-17-40-18-16-25-5-2-1-3-6-25/h1-3,5-6,8-15,19-21,24,40-41H,16-18,22-23,39H2,(H,42,44) |
| InChIKey | ZSQMGXKTIXAHFX-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.60 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|