C18H12BrIN2O — CID 18729517
[2-(5-bromo-1H-indol-3-yl)-6-iodoquinolin-4-yl]methanol (PubChem CID 18729517) has the molecular formula C18H12BrIN2O and a molecular weight of 479.12 g/mol. Its IUPAC name is [2-(5-bromo-1H-indol-3-yl)-6-iodoquinolin-4-yl]methanol.
| Compound Name | [2-(5-bromo-1H-indol-3-yl)-6-iodoquinolin-4-yl]methanol |
|---|---|
| PubChem CID | 18729517 |
| Molecular Formula | C18H12BrIN2O |
| Molecular Weight | 479.12 g/mol |
| Exact Mass | 477.92 |
| IUPAC Name | [2-(5-bromo-1H-indol-3-yl)-6-iodoquinolin-4-yl]methanol |
| SMILES | OCc1cc(-c2c[nH]c3ccc(Br)cc23)nc2ccc(I)cc12 |
| InChI | InChI=1S/C18H12BrIN2O/c19-11-1-3-16-14(6-11)15(8-21-16)18-5-10(9-23)13-7-12(20)2-4-17(13)22-18/h1-8,21,23H,9H2 |
| InChIKey | CDQBUCLLGXOANB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.12 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|