C18H32N4 — CID 171069945
butane;1-[(1-methylazetidin-3-yl)methyl]-4-pyridin-2-ylpiperazine (PubChem CID 171069945) has the molecular formula C18H32N4 and a molecular weight of 304.48 g/mol. Its IUPAC name is butane;1-[(1-methylazetidin-3-yl)methyl]-4-pyridin-2-ylpiperazine.
| Compound Name | butane;1-[(1-methylazetidin-3-yl)methyl]-4-pyridin-2-ylpiperazine |
|---|---|
| PubChem CID | 171069945 |
| Molecular Formula | C18H32N4 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | butane;1-[(1-methylazetidin-3-yl)methyl]-4-pyridin-2-ylpiperazine |
| SMILES | CCCC.CN1CC(CN2CCN(c3ccccn3)CC2)C1 |
| InChI | InChI=1S/C14H22N4.C4H10/c1-16-10-13(11-16)12-17-6-8-18(9-7-17)14-4-2-3-5-15-14;1-3-4-2/h2-5,13H,6-12H2,1H3;3-4H2,1-2H3 |
| InChIKey | CNLDIVRMLKHJHS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |