C12H14Cl2N2O3 — CID 103952600
[1-(2,6-dichloro-4-nitrophenyl)piperidin-4-yl]methanol (PubChem CID 103952600) has the molecular formula C12H14Cl2N2O3 and a molecular weight of 305.16 g/mol. Its IUPAC name is [1-(2,6-dichloro-4-nitrophenyl)piperidin-4-yl]methanol.
| Compound Name | [1-(2,6-dichloro-4-nitrophenyl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 103952600 |
| Molecular Formula | C12H14Cl2N2O3 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | [1-(2,6-dichloro-4-nitrophenyl)piperidin-4-yl]methanol |
| SMILES | O=[N+]([O-])c1cc(Cl)c(N2CCC(CO)CC2)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2N2O3/c13-10-5-9(16(18)19)6-11(14)12(10)15-3-1-8(7-17)2-4-15/h5-6,8,17H,1-4,7H2 |
| InChIKey | YKDUTNGHBCUBBW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|