C11H12Cl2N2O4 — CID 104917843
[4-(2,6-dichloro-4-nitrophenyl)morpholin-2-yl]methanol (PubChem CID 104917843) has the molecular formula C11H12Cl2N2O4 and a molecular weight of 307.13 g/mol. Its IUPAC name is [4-(2,6-dichloro-4-nitrophenyl)morpholin-2-yl]methanol.
| Compound Name | [4-(2,6-dichloro-4-nitrophenyl)morpholin-2-yl]methanol |
|---|---|
| PubChem CID | 104917843 |
| Molecular Formula | C11H12Cl2N2O4 |
| Molecular Weight | 307.13 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | [4-(2,6-dichloro-4-nitrophenyl)morpholin-2-yl]methanol |
| SMILES | O=[N+]([O-])c1cc(Cl)c(N2CCOC(CO)C2)c(Cl)c1 |
| InChI | InChI=1S/C11H12Cl2N2O4/c12-9-3-7(15(17)18)4-10(13)11(9)14-1-2-19-8(5-14)6-16/h3-4,8,16H,1-2,5-6H2 |
| InChIKey | QEXITHJGXHKVKW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.13 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|