C14H19Cl2N3O3 — CID 133484653
2-[4-(2,6-dichloro-4-nitrophenyl)piperazin-1-yl]butan-1-ol (PubChem CID 133484653) has the molecular formula C14H19Cl2N3O3 and a molecular weight of 348.23 g/mol. Its IUPAC name is 2-[4-(2,6-dichloro-4-nitrophenyl)piperazin-1-yl]butan-1-ol.
| Compound Name | 2-[4-(2,6-dichloro-4-nitrophenyl)piperazin-1-yl]butan-1-ol |
|---|---|
| PubChem CID | 133484653 |
| Molecular Formula | C14H19Cl2N3O3 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 2-[4-(2,6-dichloro-4-nitrophenyl)piperazin-1-yl]butan-1-ol |
| SMILES | CCC(CO)N1CCN(c2c(Cl)cc([N+](=O)[O-])cc2Cl)CC1 |
| InChI | InChI=1S/C14H19Cl2N3O3/c1-2-10(9-20)17-3-5-18(6-4-17)14-12(15)7-11(19(21)22)8-13(14)16/h7-8,10,20H,2-6,9H2,1H3 |
| InChIKey | DJGMBKBOHUMZNC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|