C17H22Cl2N2O5 — CID 156798394
tert-butyl 2-[1-(2,6-dichloro-4-nitrophenyl)-4-hydroxypiperidin-4-yl]acetate (PubChem CID 156798394) has the molecular formula C17H22Cl2N2O5 and a molecular weight of 405.28 g/mol. Its IUPAC name is tert-butyl 2-[1-(2,6-dichloro-4-nitrophenyl)-4-hydroxypiperidin-4-yl]acetate.
| Compound Name | tert-butyl 2-[1-(2,6-dichloro-4-nitrophenyl)-4-hydroxypiperidin-4-yl]acetate |
|---|---|
| PubChem CID | 156798394 |
| Molecular Formula | C17H22Cl2N2O5 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | tert-butyl 2-[1-(2,6-dichloro-4-nitrophenyl)-4-hydroxypiperidin-4-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1(O)CCN(c2c(Cl)cc([N+](=O)[O-])cc2Cl)CC1 |
| InChI | InChI=1S/C17H22Cl2N2O5/c1-16(2,3)26-14(22)10-17(23)4-6-20(7-5-17)15-12(18)8-11(21(24)25)9-13(15)19/h8-9,23H,4-7,10H2,1-3H3 |
| InChIKey | QPZKNLUNYMKPKF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|