C10H13ClN4O2 — CID 97162747
(2R)-1-(2-chloro-6-methylpyrimidin-4-yl)piperazine-2-carboxylic acid (PubChem CID 97162747) has the molecular formula C10H13ClN4O2 and a molecular weight of 256.69 g/mol. Its IUPAC name is (2R)-1-(2-chloro-6-methylpyrimidin-4-yl)piperazine-2-carboxylic acid.
| Compound Name | (2R)-1-(2-chloro-6-methylpyrimidin-4-yl)piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 97162747 |
| Molecular Formula | C10H13ClN4O2 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | (2R)-1-(2-chloro-6-methylpyrimidin-4-yl)piperazine-2-carboxylic acid |
| SMILES | Cc1cc(N2CCNC[C@@H]2C(=O)O)nc(Cl)n1 |
| InChI | InChI=1S/C10H13ClN4O2/c1-6-4-8(14-10(11)13-6)15-3-2-12-5-7(15)9(16)17/h4,7,12H,2-3,5H2,1H3,(H,16,17)/t7-/m1/s1 |
| InChIKey | CGGIRAFKQHPWHO-SSDOTTSWSA-N |
| XLogP | 0.30 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |