C9H11ClN4O2 — CID 97166480
(2S)-1-(4-chloropyrimidin-2-yl)piperazine-2-carboxylic acid (PubChem CID 97166480) has the molecular formula C9H11ClN4O2 and a molecular weight of 242.67 g/mol. Its IUPAC name is (2S)-1-(4-chloropyrimidin-2-yl)piperazine-2-carboxylic acid.
| Compound Name | (2S)-1-(4-chloropyrimidin-2-yl)piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 97166480 |
| Molecular Formula | C9H11ClN4O2 |
| Molecular Weight | 242.67 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | (2S)-1-(4-chloropyrimidin-2-yl)piperazine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CNCCN1c1nccc(Cl)n1 |
| InChI | InChI=1S/C9H11ClN4O2/c10-7-1-2-12-9(13-7)14-4-3-11-5-6(14)8(15)16/h1-2,6,11H,3-5H2,(H,15,16)/t6-/m0/s1 |
| InChIKey | UPRFYWNRWBETOX-LURJTMIESA-N |
| XLogP | -0.01 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.67 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |