1-pyrazolo[1,5-a]pyrazin-4-ylpiperazine-2-carboxylic acid

C11H13N5O2 — CID 113446483

IUPAC1-pyrazolo[1,5-a]pyrazin-4-ylpiperazine-2-carboxylic acid
SMILESO=C(O)C1CNCCN1c1nccn2nccc12
InChIInChI=1S/C11H13N5O2/c17-11(18)9-7-12-3-5-15(9)10-8-1-2-14-16(8)6-4-13-10/h1-2,4,6,9,12H,3,5,7H2,(H,17,18)
InChIKeyPSUBWNSJXPQWRU-UHFFFAOYSA-N
MW247.26 g/mol
LogP-0.41
Rot. Bonds2

About 1-pyrazolo[1,5-a]pyrazin-4-ylpiperazine-2-carboxylic acid

1-pyrazolo[1,5-a]pyrazin-4-ylpiperazine-2-carboxylic acid (PubChem CID 113446483) has the molecular formula C11H13N5O2 and a molecular weight of 247.26 g/mol. Its IUPAC name is 1-pyrazolo[1,5-a]pyrazin-4-ylpiperazine-2-carboxylic acid.

Molecular Properties

Compound Name1-pyrazolo[1,5-a]pyrazin-4-ylpiperazine-2-carboxylic acid
PubChem CID113446483
Molecular FormulaC11H13N5O2
Molecular Weight247.26 g/mol
Exact Mass247.11
IUPAC Name1-pyrazolo[1,5-a]pyrazin-4-ylpiperazine-2-carboxylic acid
SMILESO=C(O)C1CNCCN1c1nccn2nccc12
InChIInChI=1S/C11H13N5O2/c17-11(18)9-7-12-3-5-15(9)10-8-1-2-14-16(8)6-4-13-10/h1-2,4,6,9,12H,3,5,7H2,(H,17,18)
InChIKeyPSUBWNSJXPQWRU-UHFFFAOYSA-N
XLogP-0.41
TPSA82.76 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.26
LogP ≤ 5-0.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze 1-pyrazolo[1,5-a]pyrazin-4-ylpiperazine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-pyrazolo[1,5-a]pyrazin-4-ylpiperazine-2-carboxylic acid?
The IUPAC name of 1-pyrazolo[1,5-a]pyrazin-4-ylpiperazine-2-carboxylic acid (CID 113446483) is 1-pyrazolo[1,5-a]pyrazin-4-ylpiperazine-2-carboxylic acid.
What is the SMILES notation for 1-pyrazolo[1,5-a]pyrazin-4-ylpiperazine-2-carboxylic acid?
The canonical SMILES for 1-pyrazolo[1,5-a]pyrazin-4-ylpiperazine-2-carboxylic acid is O=C(O)C1CNCCN1c1nccn2nccc12.
What is the InChIKey of 1-pyrazolo[1,5-a]pyrazin-4-ylpiperazine-2-carboxylic acid?
The InChIKey is PSUBWNSJXPQWRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N5O2/c17-11(18)9-7-12-3-5-15(9)10-8-1-2-14-16(8)6-4-13-10/h1-2,4,6,9,12H,3,5,7H2,(H,17,18).
What are the key properties of 1-pyrazolo[1,5-a]pyrazin-4-ylpiperazine-2-carboxylic acid?
1-pyrazolo[1,5-a]pyrazin-4-ylpiperazine-2-carboxylic acid has a molecular weight of 247.26 g/mol, XLogP of -0.41, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrazolo[1,5-a]pyrazin-4-ylpiperazine-2-carboxylic acid is sourced from PubChem (CID 113446483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).