C11H9N3O6 — CID 66060839
2-(3,5-dioxopiperazin-1-yl)-4-nitrobenzoic acid (PubChem CID 66060839) has the molecular formula C11H9N3O6 and a molecular weight of 279.21 g/mol. Its IUPAC name is 2-(3,5-dioxopiperazin-1-yl)-4-nitrobenzoic acid.
| Compound Name | 2-(3,5-dioxopiperazin-1-yl)-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 66060839 |
| Molecular Formula | C11H9N3O6 |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2-(3,5-dioxopiperazin-1-yl)-4-nitrobenzoic acid |
| SMILES | O=C1CN(c2cc([N+](=O)[O-])ccc2C(=O)O)CC(=O)N1 |
| InChI | InChI=1S/C11H9N3O6/c15-9-4-13(5-10(16)12-9)8-3-6(14(19)20)1-2-7(8)11(17)18/h1-3H,4-5H2,(H,17,18)(H,12,15,16) |
| InChIKey | CCQDIXJBCWLWLD-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|