C13H12N2O6 — CID 63110711
2-(4-methyl-2,6-dioxopiperidin-1-yl)-4-nitrobenzoic acid (PubChem CID 63110711) has the molecular formula C13H12N2O6 and a molecular weight of 292.25 g/mol. Its IUPAC name is 2-(4-methyl-2,6-dioxopiperidin-1-yl)-4-nitrobenzoic acid.
| Compound Name | 2-(4-methyl-2,6-dioxopiperidin-1-yl)-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 63110711 |
| Molecular Formula | C13H12N2O6 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-(4-methyl-2,6-dioxopiperidin-1-yl)-4-nitrobenzoic acid |
| SMILES | CC1CC(=O)N(c2cc([N+](=O)[O-])ccc2C(=O)O)C(=O)C1 |
| InChI | InChI=1S/C13H12N2O6/c1-7-4-11(16)14(12(17)5-7)10-6-8(15(20)21)2-3-9(10)13(18)19/h2-3,6-7H,4-5H2,1H3,(H,18,19) |
| InChIKey | CDENGBNNIPJQHL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|