C12H11BrN2O4 — CID 63100807
1-(2-bromo-5-nitrobenzoyl)-4-methylpyrrolidin-2-one (PubChem CID 63100807) has the molecular formula C12H11BrN2O4 and a molecular weight of 327.13 g/mol. Its IUPAC name is 1-(2-bromo-5-nitrobenzoyl)-4-methylpyrrolidin-2-one.
| Compound Name | 1-(2-bromo-5-nitrobenzoyl)-4-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 63100807 |
| Molecular Formula | C12H11BrN2O4 |
| Molecular Weight | 327.13 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 1-(2-bromo-5-nitrobenzoyl)-4-methylpyrrolidin-2-one |
| SMILES | CC1CC(=O)N(C(=O)c2cc([N+](=O)[O-])ccc2Br)C1 |
| InChI | InChI=1S/C12H11BrN2O4/c1-7-4-11(16)14(6-7)12(17)9-5-8(15(18)19)2-3-10(9)13/h2-3,5,7H,4,6H2,1H3 |
| InChIKey | FZHNCJCHPZKZMD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.13 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|