C12H10BrN3O5 — CID 66061545
4-(2-bromo-5-nitrobenzoyl)-3-methylpiperazine-2,6-dione (PubChem CID 66061545) has the molecular formula C12H10BrN3O5 and a molecular weight of 356.13 g/mol. Its IUPAC name is 4-(2-bromo-5-nitrobenzoyl)-3-methylpiperazine-2,6-dione.
| Compound Name | 4-(2-bromo-5-nitrobenzoyl)-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66061545 |
| Molecular Formula | C12H10BrN3O5 |
| Molecular Weight | 356.13 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | 4-(2-bromo-5-nitrobenzoyl)-3-methylpiperazine-2,6-dione |
| SMILES | CC1C(=O)NC(=O)CN1C(=O)c1cc([N+](=O)[O-])ccc1Br |
| InChI | InChI=1S/C12H10BrN3O5/c1-6-11(18)14-10(17)5-15(6)12(19)8-4-7(16(20)21)2-3-9(8)13/h2-4,6H,5H2,1H3,(H,14,17,18) |
| InChIKey | RKQLGIXRBQDNJC-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.13 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|