C12H14N4O5 — CID 66061586
4-(1-ethyl-4-nitropyrrole-2-carbonyl)-3-methylpiperazine-2,6-dione (PubChem CID 66061586) has the molecular formula C12H14N4O5 and a molecular weight of 294.27 g/mol. Its IUPAC name is 4-(1-ethyl-4-nitropyrrole-2-carbonyl)-3-methylpiperazine-2,6-dione.
| Compound Name | 4-(1-ethyl-4-nitropyrrole-2-carbonyl)-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66061586 |
| Molecular Formula | C12H14N4O5 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-(1-ethyl-4-nitropyrrole-2-carbonyl)-3-methylpiperazine-2,6-dione |
| SMILES | CCn1cc([N+](=O)[O-])cc1C(=O)N1CC(=O)NC(=O)C1C |
| InChI | InChI=1S/C12H14N4O5/c1-3-14-5-8(16(20)21)4-9(14)12(19)15-6-10(17)13-11(18)7(15)2/h4-5,7H,3,6H2,1-2H3,(H,13,17,18) |
| InChIKey | KLXOREYEGHLGHF-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|