C12H14BrN3O3 — CID 66062932
4-(4-bromo-1-ethylpyrrole-2-carbonyl)-3-methylpiperazine-2,6-dione (PubChem CID 66062932) has the molecular formula C12H14BrN3O3 and a molecular weight of 328.17 g/mol. Its IUPAC name is 4-(4-bromo-1-ethylpyrrole-2-carbonyl)-3-methylpiperazine-2,6-dione.
| Compound Name | 4-(4-bromo-1-ethylpyrrole-2-carbonyl)-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66062932 |
| Molecular Formula | C12H14BrN3O3 |
| Molecular Weight | 328.17 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 4-(4-bromo-1-ethylpyrrole-2-carbonyl)-3-methylpiperazine-2,6-dione |
| SMILES | CCn1cc(Br)cc1C(=O)N1CC(=O)NC(=O)C1C |
| InChI | InChI=1S/C12H14BrN3O3/c1-3-15-5-8(13)4-9(15)12(19)16-6-10(17)14-11(18)7(16)2/h4-5,7H,3,6H2,1-2H3,(H,14,17,18) |
| InChIKey | NUFGQVXSASWONC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.17 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|