C12H17BrN2O2 — CID 106832479
(4-bromo-1-ethylpyrrol-2-yl)-[(3R)-3-methylmorpholin-4-yl]methanone (PubChem CID 106832479) has the molecular formula C12H17BrN2O2 and a molecular weight of 301.18 g/mol. Its IUPAC name is (4-bromo-1-ethylpyrrol-2-yl)-[(3R)-3-methylmorpholin-4-yl]methanone.
| Compound Name | (4-bromo-1-ethylpyrrol-2-yl)-[(3R)-3-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 106832479 |
| Molecular Formula | C12H17BrN2O2 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | (4-bromo-1-ethylpyrrol-2-yl)-[(3R)-3-methylmorpholin-4-yl]methanone |
| SMILES | CCn1cc(Br)cc1C(=O)N1CCOC[C@H]1C |
| InChI | InChI=1S/C12H17BrN2O2/c1-3-14-7-10(13)6-11(14)12(16)15-4-5-17-8-9(15)2/h6-7,9H,3-5,8H2,1-2H3/t9-/m1/s1 |
| InChIKey | NKWRSLVTIOXLAS-SECBINFHSA-N |
| XLogP | 2.13 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |