C13H15N3O4 — CID 66062108
4-(4-acetyl-1-methylpyrrole-2-carbonyl)-3-methylpiperazine-2,6-dione (PubChem CID 66062108) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is 4-(4-acetyl-1-methylpyrrole-2-carbonyl)-3-methylpiperazine-2,6-dione.
| Compound Name | 4-(4-acetyl-1-methylpyrrole-2-carbonyl)-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66062108 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 4-(4-acetyl-1-methylpyrrole-2-carbonyl)-3-methylpiperazine-2,6-dione |
| SMILES | CC(=O)c1cc(C(=O)N2CC(=O)NC(=O)C2C)n(C)c1 |
| InChI | InChI=1S/C13H15N3O4/c1-7-12(19)14-11(18)6-16(7)13(20)10-4-9(8(2)17)5-15(10)3/h4-5,7H,6H2,1-3H3,(H,14,18,19) |
| InChIKey | DGOXFDNINLSXKY-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|