C15H22BrN3O — CID 66210250
(4-bromo-1-ethylpyrrol-2-yl)-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methanone (PubChem CID 66210250) has the molecular formula C15H22BrN3O and a molecular weight of 340.27 g/mol. Its IUPAC name is (4-bromo-1-ethylpyrrol-2-yl)-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methanone.
| Compound Name | (4-bromo-1-ethylpyrrol-2-yl)-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methanone |
|---|---|
| PubChem CID | 66210250 |
| Molecular Formula | C15H22BrN3O |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (4-bromo-1-ethylpyrrol-2-yl)-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methanone |
| SMILES | CCC1C2CNCC2CN1C(=O)c1cc(Br)cn1CC |
| InChI | InChI=1S/C15H22BrN3O/c1-3-13-12-7-17-6-10(12)8-19(13)15(20)14-5-11(16)9-18(14)4-2/h5,9-10,12-13,17H,3-4,6-8H2,1-2H3 |
| InChIKey | TZZANLWHSQSILU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |