C11H9BrIN3O2 — CID 66093297
4-bromo-1-(2-iodo-4-nitrophenyl)-3,5-dimethylpyrazole (PubChem CID 66093297) has the molecular formula C11H9BrIN3O2 and a molecular weight of 422.02 g/mol. Its IUPAC name is 4-bromo-1-(2-iodo-4-nitrophenyl)-3,5-dimethylpyrazole.
| Compound Name | 4-bromo-1-(2-iodo-4-nitrophenyl)-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 66093297 |
| Molecular Formula | C11H9BrIN3O2 |
| Molecular Weight | 422.02 g/mol |
| Exact Mass | 420.89 |
| IUPAC Name | 4-bromo-1-(2-iodo-4-nitrophenyl)-3,5-dimethylpyrazole |
| SMILES | Cc1nn(-c2ccc([N+](=O)[O-])cc2I)c(C)c1Br |
| InChI | InChI=1S/C11H9BrIN3O2/c1-6-11(12)7(2)15(14-6)10-4-3-8(16(17)18)5-9(10)13/h3-5H,1-2H3 |
| InChIKey | ZNWMJGZUMYKMMB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.02 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|