C17H14IN5O2 — CID 27518071
[1-(2-iodophenyl)-3,5-dimethylpyrazol-4-yl]-(3-nitrophenyl)diazene (PubChem CID 27518071) has the molecular formula C17H14IN5O2 and a molecular weight of 447.24 g/mol. Its IUPAC name is [1-(2-iodophenyl)-3,5-dimethylpyrazol-4-yl]-(3-nitrophenyl)diazene.
| Compound Name | [1-(2-iodophenyl)-3,5-dimethylpyrazol-4-yl]-(3-nitrophenyl)diazene |
|---|---|
| PubChem CID | 27518071 |
| Molecular Formula | C17H14IN5O2 |
| Molecular Weight | 447.24 g/mol |
| Exact Mass | 447.02 |
| IUPAC Name | [1-(2-iodophenyl)-3,5-dimethylpyrazol-4-yl]-(3-nitrophenyl)diazene |
| SMILES | Cc1nn(-c2ccccc2I)c(C)c1/N=N/c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H14IN5O2/c1-11-17(20-19-13-6-5-7-14(10-13)23(24)25)12(2)22(21-11)16-9-4-3-8-15(16)18/h3-10H,1-2H3/b20-19+ |
| InChIKey | DUPWKGBRMFGQLT-FMQUCBEESA-N |
| XLogP | 5.42 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.24 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|