C14H11N9O2S — CID 3416204
2,5-diamino-7-methylsulfanyl-3-[(3-nitrophenyl)diazenyl]pyrazolo[1,5-a]pyrimidine-6-carbonitrile (PubChem CID 3416204) has the molecular formula C14H11N9O2S and a molecular weight of 369.37 g/mol. Its IUPAC name is 2,5-diamino-7-methylsulfanyl-3-[(3-nitrophenyl)diazenyl]pyrazolo[1,5-a]pyrimidine-6-carbonitrile.
| Compound Name | 2,5-diamino-7-methylsulfanyl-3-[(3-nitrophenyl)diazenyl]pyrazolo[1,5-a]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 3416204 |
| Molecular Formula | C14H11N9O2S |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 2,5-diamino-7-methylsulfanyl-3-[(3-nitrophenyl)diazenyl]pyrazolo[1,5-a]pyrimidine-6-carbonitrile |
| SMILES | CSc1c(C#N)c(N)nc2c(/N=N/c3cccc([N+](=O)[O-])c3)c(N)nn12 |
| InChI | InChI=1S/C14H11N9O2S/c1-26-14-9(6-15)11(16)18-13-10(12(17)21-22(13)14)20-19-7-3-2-4-8(5-7)23(24)25/h2-5H,1H3,(H2,16,18)(H2,17,21)/b20-19+ |
| InChIKey | NWUMNLBHCOXCNJ-FMQUCBEESA-N |
| XLogP | 2.81 |
| TPSA | 173.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|