C15H10N6O2 — CID 139626752
3-(aminomethyl)-6-[(3-nitrophenyl)diazenyl]benzene-1,2-dicarbonitrile (PubChem CID 139626752) has the molecular formula C15H10N6O2 and a molecular weight of 306.29 g/mol. Its IUPAC name is 3-(aminomethyl)-6-[(3-nitrophenyl)diazenyl]benzene-1,2-dicarbonitrile.
| Compound Name | 3-(aminomethyl)-6-[(3-nitrophenyl)diazenyl]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 139626752 |
| Molecular Formula | C15H10N6O2 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 3-(aminomethyl)-6-[(3-nitrophenyl)diazenyl]benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1c(CN)ccc(/N=N/c2cccc([N+](=O)[O-])c2)c1C#N |
| InChI | InChI=1S/C15H10N6O2/c16-7-10-4-5-15(14(9-18)13(10)8-17)20-19-11-2-1-3-12(6-11)21(22)23/h1-6H,7,16H2/b20-19+ |
| InChIKey | BJLBVEBPHMAHPZ-FMQUCBEESA-N |
| XLogP | 3.21 |
| TPSA | 141.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|