About 4-[(3-nitrophenyl)diazenyl]-6-phenoxybenzene-1,3-diamine
4-[(3-nitrophenyl)diazenyl]-6-phenoxybenzene-1,3-diamine (PubChem CID 163625810) has the molecular formula C18H15N5O3
and a molecular weight of 349.35 g/mol. Its IUPAC name is 4-[(3-nitrophenyl)diazenyl]-6-phenoxybenzene-1,3-diamine.
Molecular Properties
| Compound Name | 4-[(3-nitrophenyl)diazenyl]-6-phenoxybenzene-1,3-diamine |
| PubChem CID | 163625810 |
| Molecular Formula | C18H15N5O3 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 4-[(3-nitrophenyl)diazenyl]-6-phenoxybenzene-1,3-diamine |
| SMILES | Nc1cc(N)c(Oc2ccccc2)cc1/N=N/c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H15N5O3/c19-15-10-16(20)18(26-14-7-2-1-3-8-14)11-17(15)22-21-12-5-4-6-13(9-12)23(24)25/h1-11H,19-20H2/b22-21+ |
| InChIKey | HRXHZYGQDDKXGO-QURGRASLSA-N |
| XLogP | 4.97 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3-nitrophenyl)diazenyl]-6-phenoxybenzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-nitrophenyl)diazenyl]-6-phenoxybenzene-1,3-diamine?
The IUPAC name of 4-[(3-nitrophenyl)diazenyl]-6-phenoxybenzene-1,3-diamine (CID 163625810) is 4-[(3-nitrophenyl)diazenyl]-6-phenoxybenzene-1,3-diamine.
What is the SMILES notation for 4-[(3-nitrophenyl)diazenyl]-6-phenoxybenzene-1,3-diamine?
The canonical SMILES for 4-[(3-nitrophenyl)diazenyl]-6-phenoxybenzene-1,3-diamine is Nc1cc(N)c(Oc2ccccc2)cc1/N=N/c1cccc([N+](=O)[O-])c1.
What is the InChIKey of 4-[(3-nitrophenyl)diazenyl]-6-phenoxybenzene-1,3-diamine?
The InChIKey is HRXHZYGQDDKXGO-QURGRASLSA-N. The full InChI is InChI=1S/C18H15N5O3/c19-15-10-16(20)18(26-14-7-2-1-3-8-14)11-17(15)22-21-12-5-4-6-13(9-12)23(24)25/h1-11H,19-20H2/b22-21+.
What are the key properties of 4-[(3-nitrophenyl)diazenyl]-6-phenoxybenzene-1,3-diamine?
4-[(3-nitrophenyl)diazenyl]-6-phenoxybenzene-1,3-diamine has a molecular weight of 349.35 g/mol, XLogP of 4.97, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-nitrophenyl)diazenyl]-6-phenoxybenzene-1,3-diamine is sourced from PubChem (CID 163625810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).